C31H36N4O4 — CID 71452148
benzyl N-[(2S)-1-(4-naphthalen-2-ylpiperazin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate (PubChem CID 71452148) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(4-naphthalen-2-ylpiperazin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(4-naphthalen-2-ylpiperazin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 71452148 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | benzyl N-[(2S)-1-(4-naphthalen-2-ylpiperazin-1-yl)-1-oxo-6-(prop-2-enoylamino)hexan-2-yl]carbamate |
| SMILES | C=CC(=O)NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCN(c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C31H36N4O4/c1-2-29(36)32-17-9-8-14-28(33-31(38)39-23-24-10-4-3-5-11-24)30(37)35-20-18-34(19-21-35)27-16-15-25-12-6-7-13-26(25)22-27/h2-7,10-13,15-16,22,28H,1,8-9,14,17-21,23H2,(H,32,36)(H,33,38)/t28-/m0/s1 |
| InChIKey | PPQGEKONFFGRHB-NDEPHWFRSA-N |
| XLogP | 4.26 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|