C26H33IN2 — CID 71452315
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-dimethyl-[(9-methylcarbazol-2-yl)methyl]azanium iodide (PubChem CID 71452315) has the molecular formula C26H33IN2 and a molecular weight of 500.47 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-dimethyl-[(9-methylcarbazol-2-yl)methyl]azanium iodide.
| Compound Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-dimethyl-[(9-methylcarbazol-2-yl)methyl]azanium iodide |
|---|---|
| PubChem CID | 71452315 |
| Molecular Formula | C26H33IN2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-dimethyl-[(9-methylcarbazol-2-yl)methyl]azanium iodide |
| SMILES | Cn1c2ccccc2c2ccc(C[N+](C)(C)CC3=CC[C@H]4C[C@@H]3C4(C)C)cc21.[I-] |
| InChI | InChI=1S/C26H33N2.HI/c1-26(2)20-12-11-19(23(26)15-20)17-28(4,5)16-18-10-13-22-21-8-6-7-9-24(21)27(3)25(22)14-18;/h6-11,13-14,20,23H,12,15-17H2,1-5H3;1H/q+1;/p-1/t20-,23-;/m0./s1 |
| InChIKey | NGAXIULFAOMSMY-WCRWPNQISA-M |
| XLogP | 2.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|