About 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol
4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol (PubChem CID 71452356) has the molecular formula C25H22ClNO2S
and a molecular weight of 435.98 g/mol. Its IUPAC name is 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol.
Molecular Properties
| Compound Name | 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol |
| PubChem CID | 71452356 |
| Molecular Formula | C25H22ClNO2S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol |
| SMILES | CCCCc1sc(-c2ccc(Oc3ccc(Cl)cc3)cc2)nc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C25H22ClNO2S/c1-2-3-4-23-24(17-5-11-20(28)12-6-17)27-25(30-23)18-7-13-21(14-8-18)29-22-15-9-19(26)10-16-22/h5-16,28H,2-4H2,1H3 |
| InChIKey | DNVZSCSOTFWBGY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol?
The IUPAC name of 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol (CID 71452356) is 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol.
What is the SMILES notation for 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol?
The canonical SMILES for 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol is CCCCc1sc(-c2ccc(Oc3ccc(Cl)cc3)cc2)nc1-c1ccc(O)cc1.
What is the InChIKey of 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol?
The InChIKey is DNVZSCSOTFWBGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22ClNO2S/c1-2-3-4-23-24(17-5-11-20(28)12-6-17)27-25(30-23)18-7-13-21(14-8-18)29-22-15-9-19(26)10-16-22/h5-16,28H,2-4H2,1H3.
What are the key properties of 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol?
4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol has a molecular weight of 435.98 g/mol, XLogP of 7.97, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-butyl-2-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-4-yl]phenol is sourced from PubChem (CID 71452356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).