About 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid
1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid (PubChem CID 71452431) has the molecular formula C23H21N5O3S
and a molecular weight of 447.52 g/mol. Its IUPAC name is 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid |
| PubChem CID | 71452431 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2nccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C23H21N5O3S/c29-22(30)15-9-13-28(14-10-15)20-21(25-12-11-24-20)31-17-7-5-16(6-8-17)26-23-27-18-3-1-2-4-19(18)32-23/h1-8,11-12,15H,9-10,13-14H2,(H,26,27)(H,29,30) |
| InChIKey | LTOLUCFUWWZXSN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid (CID 71452431) is 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid is O=C(O)C1CCN(c2nccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)CC1.
What is the InChIKey of 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid?
The InChIKey is LTOLUCFUWWZXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N5O3S/c29-22(30)15-9-13-28(14-10-15)20-21(25-12-11-24-20)31-17-7-5-16(6-8-17)26-23-27-18-3-1-2-4-19(18)32-23/h1-8,11-12,15H,9-10,13-14H2,(H,26,27)(H,29,30).
What are the key properties of 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid?
1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid has a molecular weight of 447.52 g/mol, XLogP of 4.92, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-4-carboxylic acid is sourced from PubChem (CID 71452431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).