C23H20N4O3S2 — CID 71452523
(1S,3R,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione (PubChem CID 71452523) has the molecular formula C23H20N4O3S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (1S,3R,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione.
| Compound Name | (1S,3R,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione |
|---|---|
| PubChem CID | 71452523 |
| Molecular Formula | C23H20N4O3S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (1S,3R,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione |
| SMILES | CN1C(=O)[C@@]23C[C@@]4(c5c[nH]c6ccccc56)c5ccccc5N[C@@H]4N2C(=O)[C@]1(CO)SS3 |
| InChI | InChI=1S/C23H20N4O3S2/c1-26-19(29)22-11-21(15-10-24-16-8-4-2-6-13(15)16)14-7-3-5-9-17(14)25-18(21)27(22)20(30)23(26,12-28)32-31-22/h2-10,18,24-25,28H,11-12H2,1H3/t18-,21+,22+,23+/m1/s1 |
| InChIKey | XHPIWHHLWCZQEF-PVSGBFIBSA-N |
| XLogP | 2.69 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|