C40H39N13O — CID 71452546
4-[[4-[2-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71452546) has the molecular formula C40H39N13O and a molecular weight of 717.84 g/mol. Its IUPAC name is 4-[[4-[2-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[2-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71452546 |
| Molecular Formula | C40H39N13O |
| Molecular Weight | 717.84 g/mol |
| Exact Mass | 717.34 |
| IUPAC Name | 4-[[4-[2-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Nc2nc(NCCNc3nc(Nc4ccc(C#N)cc4)nc(Oc4c(C)cc(C)cc4C)n3)nc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C40H39N13O/c1-23-17-25(3)33(26(4)18-23)47-39-49-35(48-37(51-39)45-31-11-7-29(21-41)8-12-31)43-15-16-44-36-50-38(46-32-13-9-30(22-42)10-14-32)53-40(52-36)54-34-27(5)19-24(2)20-28(34)6/h7-14,17-20H,15-16H2,1-6H3,(H2,44,46,50,52,53)(H3,43,45,47,48,49,51) |
| InChIKey | RYIPYCXXJUGSDC-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 194.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.84 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|