C41H40N12O2 — CID 71452548
4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71452548) has the molecular formula C41H40N12O2 and a molecular weight of 732.85 g/mol. Its IUPAC name is 4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71452548 |
| Molecular Formula | C41H40N12O2 |
| Molecular Weight | 732.85 g/mol |
| Exact Mass | 732.34 |
| IUPAC Name | 4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Oc2nc(NCCCNc3nc(Nc4ccc(C#N)cc4)nc(Oc4c(C)cc(C)cc4C)n3)nc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C41H40N12O2/c1-24-18-26(3)34(27(4)19-24)54-40-50-36(48-38(52-40)46-32-12-8-30(22-42)9-13-32)44-16-7-17-45-37-49-39(47-33-14-10-31(23-43)11-15-33)53-41(51-37)55-35-28(5)20-25(2)21-29(35)6/h8-15,18-21H,7,16-17H2,1-6H3,(H2,44,46,48,50,52)(H2,45,47,49,51,53) |
| InChIKey | SFQXJJTXVFIICC-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 191.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.85 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|