C11H6FN3O2 — CID 71452587
6-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile (PubChem CID 71452587) has the molecular formula C11H6FN3O2 and a molecular weight of 231.19 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 71452587 |
| Molecular Formula | C11H6FN3O2 |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 6-(4-fluorophenyl)-2,4-dioxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(F)cc2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H6FN3O2/c12-7-3-1-6(2-4-7)9-8(5-13)10(16)15-11(17)14-9/h1-4H,(H2,14,15,16,17) |
| InChIKey | PYZXRFSLIDXXCS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |