C27H28F2N2O4 — CID 71452679
(3R,6R)-6-benzhydryl-N-[(3,4-difluorophenyl)methyl]piperidin-3-amine;oxalic acid (PubChem CID 71452679) has the molecular formula C27H28F2N2O4 and a molecular weight of 482.53 g/mol. Its IUPAC name is (3R,6R)-6-benzhydryl-N-[(3,4-difluorophenyl)methyl]piperidin-3-amine;oxalic acid.
| Compound Name | (3R,6R)-6-benzhydryl-N-[(3,4-difluorophenyl)methyl]piperidin-3-amine;oxalic acid |
|---|---|
| PubChem CID | 71452679 |
| Molecular Formula | C27H28F2N2O4 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (3R,6R)-6-benzhydryl-N-[(3,4-difluorophenyl)methyl]piperidin-3-amine;oxalic acid |
| SMILES | Fc1ccc(CN[C@@H]2CC[C@H](C(c3ccccc3)c3ccccc3)NC2)cc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H26F2N2.C2H2O4/c26-22-13-11-18(15-23(22)27)16-28-21-12-14-24(29-17-21)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20;3-1(4)2(5)6/h1-11,13,15,21,24-25,28-29H,12,14,16-17H2;(H,3,4)(H,5,6)/t21-,24-;/m1./s1 |
| InChIKey | LICNSOSQJBIWFY-MBUMRYSBSA-N |
| XLogP | 4.16 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|