C34H43N5 — CID 71452866
N',N'-dimethyl-N-[10-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]anthracen-9-yl]propane-1,3-diamine (PubChem CID 71452866) has the molecular formula C34H43N5 and a molecular weight of 521.75 g/mol. Its IUPAC name is N',N'-dimethyl-N-[10-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]anthracen-9-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[10-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]anthracen-9-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 71452866 |
| Molecular Formula | C34H43N5 |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | N',N'-dimethyl-N-[10-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]anthracen-9-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1c2ccccc2c(-c2nc3ccccn3c2NC(C)(C)CC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C34H43N5/c1-33(2,3)23-34(4,5)37-32-31(36-28-19-12-13-22-39(28)32)29-24-15-8-10-17-26(24)30(35-20-14-21-38(6)7)27-18-11-9-16-25(27)29/h8-13,15-19,22,35,37H,14,20-21,23H2,1-7H3 |
| InChIKey | NAWRGGLMWOJJLP-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 44.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|