C24H37N6O7P — CID 71452911
[[(E)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]but-2-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 71452911) has the molecular formula C24H37N6O7P and a molecular weight of 552.57 g/mol. Its IUPAC name is [[(E)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]but-2-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(E)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]but-2-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71452911 |
| Molecular Formula | C24H37N6O7P |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | [[(E)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]but-2-enyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(C/C=C/Cn1cnc2c(NC3CC3)nc(N)nc21)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H37N6O7P/c1-23(2,3)20(31)34-14-36-38(33,37-15-35-21(32)24(4,5)6)12-8-7-11-30-13-26-17-18(27-16-9-10-16)28-22(25)29-19(17)30/h7-8,13,16H,9-12,14-15H2,1-6H3,(H3,25,27,28,29)/b8-7+ |
| InChIKey | ZGISBQCHKKMJQS-BQYQJAHWSA-N |
| XLogP | 3.86 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|