C24H24ClN3O4 — CID 71452968
(1R,14S,15R)-25-methyl-6-nitro-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3(12),4,6,8,10,17(22),18,20-octaene-14,20-diol;hydrochloride (PubChem CID 71452968) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is (1R,14S,15R)-25-methyl-6-nitro-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3(12),4,6,8,10,17(22),18,20-octaene-14,20-diol;hydrochloride.
| Compound Name | (1R,14S,15R)-25-methyl-6-nitro-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3(12),4,6,8,10,17(22),18,20-octaene-14,20-diol;hydrochloride |
|---|---|
| PubChem CID | 71452968 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (1R,14S,15R)-25-methyl-6-nitro-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3(12),4,6,8,10,17(22),18,20-octaene-14,20-diol;hydrochloride |
| SMILES | CN1CC[C@]23Cc4nc5c([N+](=O)[O-])cccc5cc4C[C@@]2(O)[C@H]1Cc1ccc(O)cc13.Cl |
| InChI | InChI=1S/C24H23N3O4.ClH/c1-26-8-7-23-13-19-16(9-15-3-2-4-20(27(30)31)22(15)25-19)12-24(23,29)21(26)10-14-5-6-17(28)11-18(14)23;/h2-6,9,11,21,28-29H,7-8,10,12-13H2,1H3;1H/t21-,23-,24-;/m1./s1 |
| InChIKey | LHZLWJPJVCNYRD-BGPJRJNSSA-N |
| XLogP | 3.30 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|