C27H24F4N8O — CID 71452980
3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[[6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-7-(trifluoromethyl)quinoxalin-5-amine (PubChem CID 71452980) has the molecular formula C27H24F4N8O and a molecular weight of 552.54 g/mol. Its IUPAC name is 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[[6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-7-(trifluoromethyl)quinoxalin-5-amine.
| Compound Name | 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[[6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-7-(trifluoromethyl)quinoxalin-5-amine |
|---|---|
| PubChem CID | 71452980 |
| Molecular Formula | C27H24F4N8O |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-[[6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-7-(trifluoromethyl)quinoxalin-5-amine |
| SMILES | C[C@@H]1CN(c2cnc3cc(C(F)(F)F)cc(NCc4nnc5ccc(-c6ccc(F)cc6)nn45)c3n2)C[C@H](C)O1 |
| InChI | InChI=1S/C27H24F4N8O/c1-15-13-38(14-16(2)40-15)24-11-32-21-9-18(27(29,30)31)10-22(26(21)34-24)33-12-25-36-35-23-8-7-20(37-39(23)25)17-3-5-19(28)6-4-17/h3-11,15-16,33H,12-14H2,1-2H3/t15-,16+ |
| InChIKey | UVSVUCYFPJBDIT-IYBDPMFKSA-N |
| XLogP | 5.12 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |