C25H23ClF5N3O2 — CID 71453045
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-propylurea (PubChem CID 71453045) has the molecular formula C25H23ClF5N3O2 and a molecular weight of 527.92 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-propylurea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-propylurea |
|---|---|
| PubChem CID | 71453045 |
| Molecular Formula | C25H23ClF5N3O2 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-propylurea |
| SMILES | CCCNC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C25H23ClF5N3O2/c1-2-10-32-23(35)34-24(14-16-6-4-3-5-7-16,21-9-8-18(26)15-33-21)17-11-19(27)13-20(12-17)36-25(30,31)22(28)29/h3-9,11-13,15,22H,2,10,14H2,1H3,(H2,32,34,35)/t24-/m0/s1 |
| InChIKey | OILMOUHSDFSECV-DEOSSOPVSA-N |
| XLogP | 6.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|