About 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine
1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine (PubChem CID 71453071) has the molecular formula C22H28N2
and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine |
| PubChem CID | 71453071 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine |
| SMILES | c1ccc([C@H]([C@@H](c2ccccc2)N2CCCC2)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H28N2/c1-3-11-19(12-4-1)21(23-15-7-8-16-23)22(24-17-9-10-18-24)20-13-5-2-6-14-20/h1-6,11-14,21-22H,7-10,15-18H2/t21-,22-/m1/s1 |
| InChIKey | XAMJZICIEQIVJK-FGZHOGPDSA-N |
| XLogP | 4.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine?
The IUPAC name of 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine (CID 71453071) is 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine.
What is the SMILES notation for 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine?
The canonical SMILES for 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine is c1ccc([C@H]([C@@H](c2ccccc2)N2CCCC2)N2CCCC2)cc1.
What is the InChIKey of 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine?
The InChIKey is XAMJZICIEQIVJK-FGZHOGPDSA-N. The full InChI is InChI=1S/C22H28N2/c1-3-11-19(12-4-1)21(23-15-7-8-16-23)22(24-17-9-10-18-24)20-13-5-2-6-14-20/h1-6,11-14,21-22H,7-10,15-18H2/t21-,22-/m1/s1.
What are the key properties of 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine?
1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine has a molecular weight of 320.48 g/mol, XLogP of 4.66, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-1,2-diphenyl-2-pyrrolidin-1-ylethyl]pyrrolidine is sourced from PubChem (CID 71453071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).