C24H31FN2O3 — CID 71453083
7-fluoro-1-(4-hydroxybutyl)-4-oxo-N-[(1R,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]quinoline-3-carboxamide (PubChem CID 71453083) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is 7-fluoro-1-(4-hydroxybutyl)-4-oxo-N-[(1R,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]quinoline-3-carboxamide.
| Compound Name | 7-fluoro-1-(4-hydroxybutyl)-4-oxo-N-[(1R,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 71453083 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 7-fluoro-1-(4-hydroxybutyl)-4-oxo-N-[(1R,2S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]quinoline-3-carboxamide |
| SMILES | CC1(C)C2CC[C@](C)(C2)[C@@H]1NC(=O)c1cn(CCCCO)c2cc(F)ccc2c1=O |
| InChI | InChI=1S/C24H31FN2O3/c1-23(2)15-8-9-24(3,13-15)22(23)26-21(30)18-14-27(10-4-5-11-28)19-12-16(25)6-7-17(19)20(18)29/h6-7,12,14-15,22,28H,4-5,8-11,13H2,1-3H3,(H,26,30)/t15?,22-,24-/m1/s1 |
| InChIKey | DCAQOIFRIIZYDR-FYYUSBCQSA-N |
| XLogP | 3.86 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|