About 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide
4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide (PubChem CID 71453121) has the molecular formula C27H24F3N3O
and a molecular weight of 463.50 g/mol. Its IUPAC name is 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide.
Molecular Properties
| Compound Name | 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide |
| PubChem CID | 71453121 |
| Molecular Formula | C27H24F3N3O |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide |
| SMILES | CC(NC(=O)CCCc1ccc2cccnc2n1)c1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H24F3N3O/c1-18(19-10-12-20(13-11-19)22-5-2-7-23(17-22)27(28,29)30)32-25(34)9-3-8-24-15-14-21-6-4-16-31-26(21)33-24/h2,4-7,10-18H,3,8-9H2,1H3,(H,32,34) |
| InChIKey | AYBBJNZILBUREY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide?
The IUPAC name of 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide (CID 71453121) is 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide.
What is the SMILES notation for 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide?
The canonical SMILES for 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide is CC(NC(=O)CCCc1ccc2cccnc2n1)c1ccc(-c2cccc(C(F)(F)F)c2)cc1.
What is the InChIKey of 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide?
The InChIKey is AYBBJNZILBUREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24F3N3O/c1-18(19-10-12-20(13-11-19)22-5-2-7-23(17-22)27(28,29)30)32-25(34)9-3-8-24-15-14-21-6-4-16-31-26(21)33-24/h2,4-7,10-18H,3,8-9H2,1H3,(H,32,34).
What are the key properties of 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide?
4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide has a molecular weight of 463.50 g/mol, XLogP of 6.52, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,8-naphthyridin-2-yl)-N-[1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethyl]butanamide is sourced from PubChem (CID 71453121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).