About ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate
ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate (PubChem CID 71453122) has the molecular formula C28H27N3O3
and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate |
| PubChem CID | 71453122 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)c1 |
| InChI | InChI=1S/C28H27N3O3/c1-2-34-28(33)24-7-3-6-23(18-24)21-13-11-20(12-14-21)19-30-26(32)10-4-9-25-16-15-22-8-5-17-29-27(22)31-25/h3,5-8,11-18H,2,4,9-10,19H2,1H3,(H,30,32) |
| InChIKey | FVBVTSZSDNJMSA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate?
The IUPAC name of ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate (CID 71453122) is ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate.
What is the SMILES notation for ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate?
The canonical SMILES for ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate is CCOC(=O)c1cccc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)c1.
What is the InChIKey of ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate?
The InChIKey is FVBVTSZSDNJMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O3/c1-2-34-28(33)24-7-3-6-23(18-24)21-13-11-20(12-14-21)19-30-26(32)10-4-9-25-16-15-22-8-5-17-29-27(22)31-25/h3,5-8,11-18H,2,4,9-10,19H2,1H3,(H,30,32).
What are the key properties of ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate?
ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate has a molecular weight of 453.54 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoate is sourced from PubChem (CID 71453122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).