About 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid
3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid (PubChem CID 71453123) has the molecular formula C26H23N3O3
and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid |
| PubChem CID | 71453123 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid |
| SMILES | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C26H23N3O3/c30-24(8-2-7-23-14-13-20-6-3-15-27-25(20)29-23)28-17-18-9-11-19(12-10-18)21-4-1-5-22(16-21)26(31)32/h1,3-6,9-16H,2,7-8,17H2,(H,28,30)(H,31,32) |
| InChIKey | WKYHHIOAARWEET-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid?
The IUPAC name of 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid (CID 71453123) is 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid.
What is the SMILES notation for 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid?
The canonical SMILES for 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid is O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2cccc(C(=O)O)c2)cc1.
What is the InChIKey of 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid?
The InChIKey is WKYHHIOAARWEET-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O3/c30-24(8-2-7-23-14-13-20-6-3-15-27-25(20)29-23)28-17-18-9-11-19(12-10-18)21-4-1-5-22(16-21)26(31)32/h1,3-6,9-16H,2,7-8,17H2,(H,28,30)(H,31,32).
What are the key properties of 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid?
3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid has a molecular weight of 425.49 g/mol, XLogP of 4.63, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzoic acid is sourced from PubChem (CID 71453123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).