About 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline
4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline (PubChem CID 71453187) has the molecular formula C15H13IN2O
and a molecular weight of 362.19 g/mol. Its IUPAC name is 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline.
Molecular Properties
| Compound Name | 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline |
| PubChem CID | 71453187 |
| Molecular Formula | C15H13IN2O |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline |
| SMILES | CN(C)c1ccc(-c2nc3ccc([125I])cc3o2)cc1 |
| InChI | InChI=1S/C15H13IN2O/c1-18(2)12-6-3-10(4-7-12)15-17-13-8-5-11(16)9-14(13)19-15/h3-9H,1-2H3/i16-2 |
| InChIKey | ZDGRIJNRIGFCGI-RFLHHMENSA-N |
| XLogP | 4.17 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline?
The IUPAC name of 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline (CID 71453187) is 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline.
What is the SMILES notation for 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline?
The canonical SMILES for 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline is CN(C)c1ccc(-c2nc3ccc([125I])cc3o2)cc1.
What is the InChIKey of 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline?
The InChIKey is ZDGRIJNRIGFCGI-RFLHHMENSA-N. The full InChI is InChI=1S/C15H13IN2O/c1-18(2)12-6-3-10(4-7-12)15-17-13-8-5-11(16)9-14(13)19-15/h3-9H,1-2H3/i16-2.
What are the key properties of 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline?
4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline has a molecular weight of 362.19 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-(125I)iodo-1,3-benzoxazol-2-yl)-N,N-dimethyl(125I)aniline is sourced from PubChem (CID 71453187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).