C27H44N4O6S2 — CID 71453199
S-[5-[(3S,9S,12R)-3-(5-acetylsulfanylpentyl)-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]pentyl] ethanethioate (PubChem CID 71453199) has the molecular formula C27H44N4O6S2 and a molecular weight of 584.81 g/mol. Its IUPAC name is S-[5-[(3S,9S,12R)-3-(5-acetylsulfanylpentyl)-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]pentyl] ethanethioate.
| Compound Name | S-[5-[(3S,9S,12R)-3-(5-acetylsulfanylpentyl)-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]pentyl] ethanethioate |
|---|---|
| PubChem CID | 71453199 |
| Molecular Formula | C27H44N4O6S2 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | S-[5-[(3S,9S,12R)-3-(5-acetylsulfanylpentyl)-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]pentyl] ethanethioate |
| SMILES | CC(=O)SCCCCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](CCCCCSC(C)=O)NC(=O)C(C)(C)NC1=O |
| InChI | InChI=1S/C27H44N4O6S2/c1-18(32)38-16-9-5-7-12-20-23(34)30-27(3,4)26(37)29-21(13-8-6-10-17-39-19(2)33)25(36)31-15-11-14-22(31)24(35)28-20/h20-22H,5-17H2,1-4H3,(H,28,35)(H,29,37)(H,30,34)/t20-,21-,22+/m0/s1 |
| InChIKey | FISBIMNWLAHVKP-FDFHNCONSA-N |
| XLogP | 2.54 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|