C24H25F3N2O7 — CID 71453231
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-[(4-phenylmethoxyphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 71453231) has the molecular formula C24H25F3N2O7 and a molecular weight of 510.47 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-[(4-phenylmethoxyphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-[(4-phenylmethoxyphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71453231 |
| Molecular Formula | C24H25F3N2O7 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[4-[(4-phenylmethoxyphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2n[nH]c(C(F)(F)F)c2Cc2ccc(OCc3ccccc3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H25F3N2O7/c25-24(26,27)21-16(10-13-6-8-15(9-7-13)34-12-14-4-2-1-3-5-14)22(29-28-21)36-23-20(33)19(32)18(31)17(11-30)35-23/h1-9,17-20,23,30-33H,10-12H2,(H,28,29)/t17-,18-,19+,20-,23+/m1/s1 |
| InChIKey | PZUKKHAOFDDMDG-MZSWFSNMSA-N |
| XLogP | 1.78 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |