C19H18F3N3O3S — CID 71453237
2-phenyl-4-[6-(2,2,2-trifluoroethylsulfonyl)-1H-benzimidazol-2-yl]morpholine (PubChem CID 71453237) has the molecular formula C19H18F3N3O3S and a molecular weight of 425.43 g/mol. Its IUPAC name is 2-phenyl-4-[6-(2,2,2-trifluoroethylsulfonyl)-1H-benzimidazol-2-yl]morpholine.
| Compound Name | 2-phenyl-4-[6-(2,2,2-trifluoroethylsulfonyl)-1H-benzimidazol-2-yl]morpholine |
|---|---|
| PubChem CID | 71453237 |
| Molecular Formula | C19H18F3N3O3S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-phenyl-4-[6-(2,2,2-trifluoroethylsulfonyl)-1H-benzimidazol-2-yl]morpholine |
| SMILES | O=S(=O)(CC(F)(F)F)c1ccc2nc(N3CCOC(c4ccccc4)C3)[nH]c2c1 |
| InChI | InChI=1S/C19H18F3N3O3S/c20-19(21,22)12-29(26,27)14-6-7-15-16(10-14)24-18(23-15)25-8-9-28-17(11-25)13-4-2-1-3-5-13/h1-7,10,17H,8-9,11-12H2,(H,23,24) |
| InChIKey | PHIHUSKNIVVTLO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |