About (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one
(4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one (PubChem CID 71453285) has the molecular formula C13H13NO3S2
and a molecular weight of 295.39 g/mol. Its IUPAC name is (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one.
Molecular Properties
| Compound Name | (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one |
| PubChem CID | 71453285 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one |
| SMILES | CSC(=CC(=O)/C=C/c1cccc([N+](=O)[O-])c1)SC |
| InChI | InChI=1S/C13H13NO3S2/c1-18-13(19-2)9-12(15)7-6-10-4-3-5-11(8-10)14(16)17/h3-9H,1-2H3/b7-6+ |
| InChIKey | MXGYOHJDOYQBJY-VOTSOKGWSA-N |
| XLogP | 3.74 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one?
The IUPAC name of (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one (CID 71453285) is (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one.
What is the SMILES notation for (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one?
The canonical SMILES for (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one is CSC(=CC(=O)/C=C/c1cccc([N+](=O)[O-])c1)SC.
What is the InChIKey of (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one?
The InChIKey is MXGYOHJDOYQBJY-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H13NO3S2/c1-18-13(19-2)9-12(15)7-6-10-4-3-5-11(8-10)14(16)17/h3-9H,1-2H3/b7-6+.
What are the key properties of (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one?
(4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one has a molecular weight of 295.39 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-1,1-bis(methylsulfanyl)-5-(3-nitrophenyl)penta-1,4-dien-3-one is sourced from PubChem (CID 71453285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).