C24H28N6O2 — CID 71453315
[3-[[4-(benzotriazole-1-carbonyl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone (PubChem CID 71453315) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is [3-[[4-(benzotriazole-1-carbonyl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-[[4-(benzotriazole-1-carbonyl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 71453315 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [3-[[4-(benzotriazole-1-carbonyl)piperazin-1-yl]methyl]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cccc(CN2CCN(C(=O)n3nnc4ccccc43)CC2)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H28N6O2/c31-23(28-11-4-1-5-12-28)20-8-6-7-19(17-20)18-27-13-15-29(16-14-27)24(32)30-22-10-3-2-9-21(22)25-26-30/h2-3,6-10,17H,1,4-5,11-16,18H2 |
| InChIKey | XCIPQKNYTRLMII-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |