C33H28ClNO4 — CID 71453317
3,4,10,11-tetramethoxy-2-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium chloride (PubChem CID 71453317) has the molecular formula C33H28ClNO4 and a molecular weight of 538.04 g/mol. Its IUPAC name is 3,4,10,11-tetramethoxy-2-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium chloride.
| Compound Name | 3,4,10,11-tetramethoxy-2-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium chloride |
|---|---|
| PubChem CID | 71453317 |
| Molecular Formula | C33H28ClNO4 |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 3,4,10,11-tetramethoxy-2-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium chloride |
| SMILES | COc1cc2cc3c4cc(-c5ccc(-c6ccccc6)cc5)c(OC)c(OC)c4cc[n+]3cc2cc1OC.[Cl-] |
| InChI | InChI=1S/C33H28NO4.ClH/c1-35-30-17-24-16-29-28-19-27(23-12-10-22(11-13-23)21-8-6-5-7-9-21)33(38-4)32(37-3)26(28)14-15-34(29)20-25(24)18-31(30)36-2;/h5-20H,1-4H3;1H/q+1;/p-1 |
| InChIKey | UOYGPSODUUXNNJ-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 41.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|