About 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile
5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile (PubChem CID 71453394) has the molecular formula C15H7N5O
and a molecular weight of 273.26 g/mol. Its IUPAC name is 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile |
| PubChem CID | 71453394 |
| Molecular Formula | C15H7N5O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2nc(-c3ccccn3)no2)c1 |
| InChI | InChI=1S/C15H7N5O/c16-8-10-5-11(9-17)7-12(6-10)15-19-14(20-21-15)13-3-1-2-4-18-13/h1-7H |
| InChIKey | XQDIXUWHADHFDT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile?
The IUPAC name of 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile (CID 71453394) is 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile?
The canonical SMILES for 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile is N#Cc1cc(C#N)cc(-c2nc(-c3ccccn3)no2)c1.
What is the InChIKey of 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile?
The InChIKey is XQDIXUWHADHFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7N5O/c16-8-10-5-11(9-17)7-12(6-10)15-19-14(20-21-15)13-3-1-2-4-18-13/h1-7H.
What are the key properties of 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile?
5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile has a molecular weight of 273.26 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-dicarbonitrile is sourced from PubChem (CID 71453394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).