C22H26N2O — CID 71453412
1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2,3-diphenylpropan-1-one (PubChem CID 71453412) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2,3-diphenylpropan-1-one.
| Compound Name | 1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 71453412 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2,3-diphenylpropan-1-one |
| SMILES | CN1C[C@@H]2CN(C(=O)C(Cc3ccccc3)c3ccccc3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H26N2O/c1-23-13-19-15-24(16-20(19)14-23)22(25)21(18-10-6-3-7-11-18)12-17-8-4-2-5-9-17/h2-11,19-21H,12-16H2,1H3/t19-,20+,21? |
| InChIKey | SPYKXMZHFPJXHE-WCRBZPEASA-N |
| XLogP | 3.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |