About 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine
6-phenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 71453442) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 71453442 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1c(-c2ccccc2)cnc2ccnn12 |
| InChI | InChI=1S/C12H10N4/c13-12-10(9-4-2-1-3-5-9)8-14-11-6-7-15-16(11)12/h1-8H,13H2 |
| InChIKey | SYLVROKSBNATLN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine (CID 71453442) is 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine is Nc1c(-c2ccccc2)cnc2ccnn12.
What is the InChIKey of 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is SYLVROKSBNATLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c13-12-10(9-4-2-1-3-5-9)8-14-11-6-7-15-16(11)12/h1-8H,13H2.
What are the key properties of 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine?
6-phenylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 210.24 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 71453442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).