C22H23NO4 — CID 71453514
benzyl 3-methyl-4-piperidin-4-yloxy-1-benzofuran-2-carboxylate (PubChem CID 71453514) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is benzyl 3-methyl-4-piperidin-4-yloxy-1-benzofuran-2-carboxylate.
| Compound Name | benzyl 3-methyl-4-piperidin-4-yloxy-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 71453514 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | benzyl 3-methyl-4-piperidin-4-yloxy-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCc2ccccc2)oc2cccc(OC3CCNCC3)c12 |
| InChI | InChI=1S/C22H23NO4/c1-15-20-18(26-17-10-12-23-13-11-17)8-5-9-19(20)27-21(15)22(24)25-14-16-6-3-2-4-7-16/h2-9,17,23H,10-14H2,1H3 |
| InChIKey | JEBFVIXVDRXPMH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |