About 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride
2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride (PubChem CID 71453643) has the molecular formula C11H15ClN2O2
and a molecular weight of 242.71 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride |
| PubChem CID | 71453643 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)Oc1cccc2c1CCN2.Cl |
| InChI | InChI=1S/C11H14N2O2.ClH/c1-13(2)11(14)15-10-5-3-4-9-8(10)6-7-12-9;/h3-5,12H,6-7H2,1-2H3;1H |
| InChIKey | SIXHZFPXNVKJEC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride?
The IUPAC name of 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride (CID 71453643) is 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride.
What is the SMILES notation for 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride?
The canonical SMILES for 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride is CN(C)C(=O)Oc1cccc2c1CCN2.Cl.
What is the InChIKey of 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride?
The InChIKey is SIXHZFPXNVKJEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2.ClH/c1-13(2)11(14)15-10-5-3-4-9-8(10)6-7-12-9;/h3-5,12H,6-7H2,1-2H3;1H.
What are the key properties of 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride?
2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride has a molecular weight of 242.71 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indol-4-yl N,N-dimethylcarbamate;hydrochloride is sourced from PubChem (CID 71453643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).