C30H32N8 — CID 71453678
9-(3,5-dimethylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenylpurine-2,8-diamine (PubChem CID 71453678) has the molecular formula C30H32N8 and a molecular weight of 504.64 g/mol. Its IUPAC name is 9-(3,5-dimethylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenylpurine-2,8-diamine.
| Compound Name | 9-(3,5-dimethylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenylpurine-2,8-diamine |
|---|---|
| PubChem CID | 71453678 |
| Molecular Formula | C30H32N8 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 9-(3,5-dimethylphenyl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-phenylpurine-2,8-diamine |
| SMILES | Cc1cc(C)cc(-n2c(Nc3ccccc3)nc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C30H32N8/c1-21-17-22(2)19-26(18-21)38-28-27(34-30(38)33-23-7-5-4-6-8-23)20-31-29(35-28)32-24-9-11-25(12-10-24)37-15-13-36(3)14-16-37/h4-12,17-20H,13-16H2,1-3H3,(H,33,34)(H,31,32,35) |
| InChIKey | AIQDQGZKQMGGGZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|