About (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one
(5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one (PubChem CID 71453698) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one.
Molecular Properties
| Compound Name | (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one |
| PubChem CID | 71453698 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one |
| SMILES | CCC1=C[C@@](CC)(C[C@@H](CC)CCC(C)=O)OC1=O |
| InChI | InChI=1S/C16H26O3/c1-5-13(9-8-12(4)17)10-16(7-3)11-14(6-2)15(18)19-16/h11,13H,5-10H2,1-4H3/t13-,16+/m0/s1 |
| InChIKey | UVNLRSLXWNPGTF-XJKSGUPXSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one?
The IUPAC name of (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one (CID 71453698) is (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one.
What is the SMILES notation for (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one?
The canonical SMILES for (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one is CCC1=C[C@@](CC)(C[C@@H](CC)CCC(C)=O)OC1=O.
What is the InChIKey of (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one?
The InChIKey is UVNLRSLXWNPGTF-XJKSGUPXSA-N. The full InChI is InChI=1S/C16H26O3/c1-5-13(9-8-12(4)17)10-16(7-3)11-14(6-2)15(18)19-16/h11,13H,5-10H2,1-4H3/t13-,16+/m0/s1.
What are the key properties of (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one?
(5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one has a molecular weight of 266.38 g/mol, XLogP of 3.81, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,5-diethyl-5-[(2S)-2-ethyl-5-oxohexyl]furan-2-one is sourced from PubChem (CID 71453698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).