About 4-cyclohexylbutyl 2-hydroxybutanoate
4-cyclohexylbutyl 2-hydroxybutanoate (PubChem CID 71453719) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-cyclohexylbutyl 2-hydroxybutanoate.
Molecular Properties
| Compound Name | 4-cyclohexylbutyl 2-hydroxybutanoate |
| PubChem CID | 71453719 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 4-cyclohexylbutyl 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)OCCCCC1CCCCC1 |
| InChI | InChI=1S/C14H26O3/c1-2-13(15)14(16)17-11-7-6-10-12-8-4-3-5-9-12/h12-13,15H,2-11H2,1H3 |
| InChIKey | WRGZUYIQNOJIDA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbutyl 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutyl 2-hydroxybutanoate?
The IUPAC name of 4-cyclohexylbutyl 2-hydroxybutanoate (CID 71453719) is 4-cyclohexylbutyl 2-hydroxybutanoate.
What is the SMILES notation for 4-cyclohexylbutyl 2-hydroxybutanoate?
The canonical SMILES for 4-cyclohexylbutyl 2-hydroxybutanoate is CCC(O)C(=O)OCCCCC1CCCCC1.
What is the InChIKey of 4-cyclohexylbutyl 2-hydroxybutanoate?
The InChIKey is WRGZUYIQNOJIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-2-13(15)14(16)17-11-7-6-10-12-8-4-3-5-9-12/h12-13,15H,2-11H2,1H3.
What are the key properties of 4-cyclohexylbutyl 2-hydroxybutanoate?
4-cyclohexylbutyl 2-hydroxybutanoate has a molecular weight of 242.36 g/mol, XLogP of 3.05, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutyl 2-hydroxybutanoate is sourced from PubChem (CID 71453719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).