C20H25N3O4S — CID 71453724
7-[[5-[2-(diethylamino)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-3,4-dimethylchromen-2-one (PubChem CID 71453724) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 7-[[5-[2-(diethylamino)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[[5-[2-(diethylamino)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 71453724 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 7-[[5-[2-(diethylamino)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]methoxy]-3,4-dimethylchromen-2-one |
| SMILES | CCN(CC)CCSc1nnc(COc2ccc3c(C)c(C)c(=O)oc3c2)o1 |
| InChI | InChI=1S/C20H25N3O4S/c1-5-23(6-2)9-10-28-20-22-21-18(27-20)12-25-15-7-8-16-13(3)14(4)19(24)26-17(16)11-15/h7-8,11H,5-6,9-10,12H2,1-4H3 |
| InChIKey | HKGNTONFNOVELX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|