C29H40O3 — CID 71453732
(6R,8R,9S,10R,13S,14S)-6-dec-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 71453732) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is (6R,8R,9S,10R,13S,14S)-6-dec-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6R,8R,9S,10R,13S,14S)-6-dec-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 71453732 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (6R,8R,9S,10R,13S,14S)-6-dec-2-ynoxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CCCCCCCC#CCO[C@@H]1C[C@@H]2[C@H](CC[C@]3(C)C(=O)CC[C@@H]23)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C29H40O3/c1-4-5-6-7-8-9-10-11-18-32-26-20-22-23-12-13-27(31)29(23,3)17-15-24(22)28(2)16-14-21(30)19-25(26)28/h14,16,19,22-24,26H,4-9,12-13,15,17-18,20H2,1-3H3/t22-,23-,24-,26+,28+,29-/m0/s1 |
| InChIKey | PKPMKVLHGZEUSZ-MFKATJNZSA-N |
| XLogP | 6.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|