C18H22N2O2 — CID 71453989
(13Z)-21-methyl-8,17-dioxa-19,21-diazatricyclo[16.2.1.02,7]henicosa-1(20),2,4,6,13,18-hexaene (PubChem CID 71453989) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (13Z)-21-methyl-8,17-dioxa-19,21-diazatricyclo[16.2.1.02,7]henicosa-1(20),2,4,6,13,18-hexaene.
| Compound Name | (13Z)-21-methyl-8,17-dioxa-19,21-diazatricyclo[16.2.1.02,7]henicosa-1(20),2,4,6,13,18-hexaene |
|---|---|
| PubChem CID | 71453989 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (13Z)-21-methyl-8,17-dioxa-19,21-diazatricyclo[16.2.1.02,7]henicosa-1(20),2,4,6,13,18-hexaene |
| SMILES | Cn1c2cnc1OCC/C=C\CCCCOc1ccccc1-2 |
| InChI | InChI=1S/C18H22N2O2/c1-20-16-14-19-18(20)22-13-9-5-3-2-4-8-12-21-17-11-7-6-10-15(16)17/h3,5-7,10-11,14H,2,4,8-9,12-13H2,1H3/b5-3- |
| InChIKey | AGLKQNJMUAORON-HYXAFXHYSA-N |
| XLogP | 3.97 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|