About 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one
6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one (PubChem CID 71454022) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one.
Molecular Properties
| Compound Name | 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one |
| PubChem CID | 71454022 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one |
| SMILES | CCCCn1ccc2cc(-c3cc(-c4ccccc4)cc(=O)n3O)cnc21 |
| InChI | InChI=1S/C22H21N3O2/c1-2-3-10-24-11-9-17-12-19(15-23-22(17)24)20-13-18(14-21(26)25(20)27)16-7-5-4-6-8-16/h4-9,11-15,27H,2-3,10H2,1H3 |
| InChIKey | BHQOTGDLLAGNKF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one?
The IUPAC name of 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one (CID 71454022) is 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one.
What is the SMILES notation for 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one?
The canonical SMILES for 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one is CCCCn1ccc2cc(-c3cc(-c4ccccc4)cc(=O)n3O)cnc21.
What is the InChIKey of 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one?
The InChIKey is BHQOTGDLLAGNKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-2-3-10-24-11-9-17-12-19(15-23-22(17)24)20-13-18(14-21(26)25(20)27)16-7-5-4-6-8-16/h4-9,11-15,27H,2-3,10H2,1H3.
What are the key properties of 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one?
6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one has a molecular weight of 359.43 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-butylpyrrolo[2,3-b]pyridin-5-yl)-1-hydroxy-4-phenylpyridin-2-one is sourced from PubChem (CID 71454022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).