C19H21FO3 — CID 71454053
(3S,3aR,7aS)-3-[[3-fluoro-4-(methoxymethoxy)phenyl]methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one (PubChem CID 71454053) has the molecular formula C19H21FO3 and a molecular weight of 316.37 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-[[3-fluoro-4-(methoxymethoxy)phenyl]methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one.
| Compound Name | (3S,3aR,7aS)-3-[[3-fluoro-4-(methoxymethoxy)phenyl]methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 71454053 |
| Molecular Formula | C19H21FO3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (3S,3aR,7aS)-3-[[3-fluoro-4-(methoxymethoxy)phenyl]methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one |
| SMILES | C=C1C=CC(=O)[C@@H]2[C@H](Cc3ccc(OCOC)c(F)c3)CC[C@H]12 |
| InChI | InChI=1S/C19H21FO3/c1-12-3-7-17(21)19-14(5-6-15(12)19)9-13-4-8-18(16(20)10-13)23-11-22-2/h3-4,7-8,10,14-15,19H,1,5-6,9,11H2,2H3/t14-,15+,19+/m0/s1 |
| InChIKey | FPQFXPFRXORFHM-QMTMVMCOSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|