C17H17FO2 — CID 71454054
(3S,3aR,7aS)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one (PubChem CID 71454054) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one.
| Compound Name | (3S,3aR,7aS)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 71454054 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3S,3aR,7aS)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-7-methylidene-2,3,3a,7a-tetrahydro-1H-inden-4-one |
| SMILES | C=C1C=CC(=O)[C@@H]2[C@H](Cc3ccc(O)c(F)c3)CC[C@H]12 |
| InChI | InChI=1S/C17H17FO2/c1-10-2-6-16(20)17-12(4-5-13(10)17)8-11-3-7-15(19)14(18)9-11/h2-3,6-7,9,12-13,17,19H,1,4-5,8H2/t12-,13+,17+/m0/s1 |
| InChIKey | BBKLQYYMZQHOBN-OGHNNQOOSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |