C18H16O9 — CID 71454293
(1R,8R,9R,13S)-6,13-diacetyl-5,9,10-trihydroxy-8,11-dimethyl-2,14-dioxatetracyclo[7.5.0.01,13.03,8]tetradeca-3,5,10-triene-7,12-dione (PubChem CID 71454293) has the molecular formula C18H16O9 and a molecular weight of 376.32 g/mol. Its IUPAC name is (1R,8R,9R,13S)-6,13-diacetyl-5,9,10-trihydroxy-8,11-dimethyl-2,14-dioxatetracyclo[7.5.0.01,13.03,8]tetradeca-3,5,10-triene-7,12-dione.
| Compound Name | (1R,8R,9R,13S)-6,13-diacetyl-5,9,10-trihydroxy-8,11-dimethyl-2,14-dioxatetracyclo[7.5.0.01,13.03,8]tetradeca-3,5,10-triene-7,12-dione |
|---|---|
| PubChem CID | 71454293 |
| Molecular Formula | C18H16O9 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (1R,8R,9R,13S)-6,13-diacetyl-5,9,10-trihydroxy-8,11-dimethyl-2,14-dioxatetracyclo[7.5.0.01,13.03,8]tetradeca-3,5,10-triene-7,12-dione |
| SMILES | CC(=O)C1=C(O)C=C2O[C@]34O[C@@]3(C(C)=O)C(=O)C(C)=C(O)[C@]4(O)[C@@]2(C)C1=O |
| InChI | InChI=1S/C18H16O9/c1-6-12(22)16(8(3)20)18(27-16)17(25,13(6)23)15(4)10(26-18)5-9(21)11(7(2)19)14(15)24/h5,21,23,25H,1-4H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | URWDTWBQFIXPCU-OWSLCNJRSA-N |
| XLogP | 0.09 |
| TPSA | 150.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|