About 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine
3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine (PubChem CID 71454298) has the molecular formula C10H11FN2O
and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine.
Molecular Properties
| Compound Name | 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine |
| PubChem CID | 71454298 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine |
| SMILES | Fc1ncccc1OC[C@@H]1C=CCN1 |
| InChI | InChI=1S/C10H11FN2O/c11-10-9(4-2-6-13-10)14-7-8-3-1-5-12-8/h1-4,6,8,12H,5,7H2/t8-/m0/s1 |
| InChIKey | GHHQHFNDKOQCRS-QMMMGPOBSA-N |
| XLogP | 1.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine?
The IUPAC name of 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine (CID 71454298) is 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine.
What is the SMILES notation for 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine?
The canonical SMILES for 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine is Fc1ncccc1OC[C@@H]1C=CCN1.
What is the InChIKey of 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine?
The InChIKey is GHHQHFNDKOQCRS-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11FN2O/c11-10-9(4-2-6-13-10)14-7-8-3-1-5-12-8/h1-4,6,8,12H,5,7H2/t8-/m0/s1.
What are the key properties of 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine?
3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine has a molecular weight of 194.21 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S)-2,5-dihydro-1H-pyrrol-2-yl]methoxy]-2-fluoropyridine is sourced from PubChem (CID 71454298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).