C43H49N13 — CID 71454314
4-[[4-[3-[[4,6-bis(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71454314) has the molecular formula C43H49N13 and a molecular weight of 747.96 g/mol. Its IUPAC name is 4-[[4-[3-[[4,6-bis(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[3-[[4,6-bis(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71454314 |
| Molecular Formula | C43H49N13 |
| Molecular Weight | 747.96 g/mol |
| Exact Mass | 747.42 |
| IUPAC Name | 4-[[4-[3-[[4,6-bis(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,4,6-trimethylanilino)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Nc2nc(NCCCNc3nc(Nc4c(C)cc(C)cc4C)nc(Nc4c(C)cc(C)cc4C)n3)nc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C43H49N13/c1-24-17-27(4)35(28(5)18-24)48-41-52-38(51-40(55-41)47-34-13-11-33(23-44)12-14-34)45-15-10-16-46-39-53-42(49-36-29(6)19-25(2)20-30(36)7)56-43(54-39)50-37-31(8)21-26(3)22-32(37)9/h11-14,17-22H,10,15-16H2,1-9H3,(H3,45,47,48,51,52,55)(H3,46,49,50,53,54,56) |
| InChIKey | BAXXLPTXOCXGMD-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 173.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.96 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|