C43H44N12O2 — CID 71454316
4-[[4-[5-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]pentylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71454316) has the molecular formula C43H44N12O2 and a molecular weight of 760.91 g/mol. Its IUPAC name is 4-[[4-[5-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]pentylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[5-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]pentylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71454316 |
| Molecular Formula | C43H44N12O2 |
| Molecular Weight | 760.91 g/mol |
| Exact Mass | 760.37 |
| IUPAC Name | 4-[[4-[5-[[4-(4-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]pentylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Oc2nc(NCCCCCNc3nc(Nc4ccc(C#N)cc4)nc(Oc4c(C)cc(C)cc4C)n3)nc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C43H44N12O2/c1-26-20-28(3)36(29(4)21-26)56-42-52-38(50-40(54-42)48-34-14-10-32(24-44)11-15-34)46-18-8-7-9-19-47-39-51-41(49-35-16-12-33(25-45)13-17-35)55-43(53-39)57-37-30(5)22-27(2)23-31(37)6/h10-17,20-23H,7-9,18-19H2,1-6H3,(H2,46,48,50,52,54)(H2,47,49,51,53,55) |
| InChIKey | IALCBUGLHFSBCX-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 191.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.91 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|