C38H40N10O2 — CID 71454317
4-N-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 71454317) has the molecular formula C38H40N10O2 and a molecular weight of 668.81 g/mol. Its IUPAC name is 4-N-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71454317 |
| Molecular Formula | C38H40N10O2 |
| Molecular Weight | 668.81 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | 4-N-[2-[[4-anilino-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-6-(2,4,6-trimethylphenoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)c(Oc2nc(NCCNc3nc(Nc4ccccc4)nc(Oc4c(C)cc(C)cc4C)n3)nc(Nc3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C38H40N10O2/c1-23-19-25(3)31(26(4)20-23)49-37-45-33(43-35(47-37)41-29-13-9-7-10-14-29)39-17-18-40-34-44-36(42-30-15-11-8-12-16-30)48-38(46-34)50-32-27(5)21-24(2)22-28(32)6/h7-16,19-22H,17-18H2,1-6H3,(H2,39,41,43,45,47)(H2,40,42,44,46,48) |
| InChIKey | XHCFUQQHHBMEFY-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.81 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|