C11H19NaO8S — CID 71454420
sodium 4-hydroxy-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate (PubChem CID 71454420) has the molecular formula C11H19NaO8S and a molecular weight of 334.32 g/mol. Its IUPAC name is sodium 4-hydroxy-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate.
| Compound Name | sodium 4-hydroxy-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 71454420 |
| Molecular Formula | C11H19NaO8S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | sodium 4-hydroxy-2-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfanyl]butanoate |
| SMILES | CO[C@@H]1O[C@@H](CSC(CCO)C(=O)[O-])[C@@H](O)[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C11H20O8S.Na/c1-18-11-9(15)8(14)7(13)5(19-11)4-20-6(2-3-12)10(16)17;/h5-9,11-15H,2-4H2,1H3,(H,16,17);/q;+1/p-1/t5-,6?,7+,8-,9-,11+;/m0./s1 |
| InChIKey | KEJIMGYZTGIXHF-XGEDBDGISA-M |
| XLogP | -6.32 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |