About N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline
N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline (PubChem CID 71454484) has the molecular formula C21H29N3
and a molecular weight of 323.48 g/mol. Its IUPAC name is N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline.
Molecular Properties
| Compound Name | N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline |
| PubChem CID | 71454484 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline |
| SMILES | C[C@H]1CN(CCCN(c2ccccc2)c2ccccc2)C[C@H](C)N1 |
| InChI | InChI=1S/C21H29N3/c1-18-16-23(17-19(2)22-18)14-9-15-24(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,18-19,22H,9,14-17H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | UDPONPQEXNUGCI-OALUTQOASA-N |
| XLogP | 3.90 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline?
The IUPAC name of N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline (CID 71454484) is N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline.
What is the SMILES notation for N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline?
The canonical SMILES for N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline is C[C@H]1CN(CCCN(c2ccccc2)c2ccccc2)C[C@H](C)N1.
What is the InChIKey of N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline?
The InChIKey is UDPONPQEXNUGCI-OALUTQOASA-N. The full InChI is InChI=1S/C21H29N3/c1-18-16-23(17-19(2)22-18)14-9-15-24(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,18-19,22H,9,14-17H2,1-2H3/t18-,19-/m0/s1.
What are the key properties of N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline?
N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline has a molecular weight of 323.48 g/mol, XLogP of 3.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3S,5S)-3,5-dimethylpiperazin-1-yl]propyl]-N-phenylaniline is sourced from PubChem (CID 71454484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).