C19H24ClNO6 — CID 71454864
(3S)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol;hydrochloride (PubChem CID 71454864) has the molecular formula C19H24ClNO6 and a molecular weight of 397.86 g/mol. Its IUPAC name is (3S)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol;hydrochloride.
| Compound Name | (3S)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol;hydrochloride |
|---|---|
| PubChem CID | 71454864 |
| Molecular Formula | C19H24ClNO6 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (3S)-3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol;hydrochloride |
| SMILES | COc1cccc(OC)c1OCCNC[C@H]1COc2cccc(O)c2O1.Cl |
| InChI | InChI=1S/C19H23NO6.ClH/c1-22-15-6-4-7-16(23-2)19(15)24-10-9-20-11-13-12-25-17-8-3-5-14(21)18(17)26-13;/h3-8,13,20-21H,9-12H2,1-2H3;1H/t13-;/m0./s1 |
| InChIKey | IECDJRLGTAPRLT-ZOWNYOTGSA-N |
| XLogP | 2.64 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|