C18H17N3OS — CID 71454952
9-(3-methoxyphenyl)-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine (PubChem CID 71454952) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 9-(3-methoxyphenyl)-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine.
| Compound Name | 9-(3-methoxyphenyl)-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
|---|---|
| PubChem CID | 71454952 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 9-(3-methoxyphenyl)-3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
| SMILES | [H]/N=C1\Sc2cc(-c3cccc(OC)c3)ccc2C2=NCCCN21 |
| InChI | InChI=1S/C18H17N3OS/c1-22-14-5-2-4-12(10-14)13-6-7-15-16(11-13)23-18(19)21-9-3-8-20-17(15)21/h2,4-7,10-11,19H,3,8-9H2,1H3/b19-18- |
| InChIKey | JKRGUBIRESILHR-HNENSFHCSA-N |
| XLogP | 3.85 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|