C21H23N7O4 — CID 71455025
4-[4-(benzotriazole-1-carbonyl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 71455025) has the molecular formula C21H23N7O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is 4-[4-(benzotriazole-1-carbonyl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[4-(benzotriazole-1-carbonyl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 71455025 |
| Molecular Formula | C21H23N7O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 4-[4-(benzotriazole-1-carbonyl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N2CCN(C(=O)n3nnc4ccccc43)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N7O4/c1-14(2)22-20(29)15-7-8-18(19(13-15)28(31)32)25-9-11-26(12-10-25)21(30)27-17-6-4-3-5-16(17)23-24-27/h3-8,13-14H,9-12H2,1-2H3,(H,22,29) |
| InChIKey | CNDXLYXHWHHBSP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|